C24H35NOS — CID 91094405
(3aS,3bS,9aR,9bR,11aR)-6,9a,11a-trimethyl-1-(thiophen-2-ylmethyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 91094405) has the molecular formula C24H35NOS and a molecular weight of 385.62 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aR)-6,9a,11a-trimethyl-1-(thiophen-2-ylmethyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aR)-6,9a,11a-trimethyl-1-(thiophen-2-ylmethyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 91094405 |
| Molecular Formula | C24H35NOS |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aR)-6,9a,11a-trimethyl-1-(thiophen-2-ylmethyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(Cc3cccs3)CC[C@@H]12 |
| InChI | InChI=1S/C24H35NOS/c1-23-12-10-20-18(7-9-21-24(20,2)13-11-22(26)25(21)3)19(23)8-6-16(23)15-17-5-4-14-27-17/h4-5,14,16,18-21H,6-13,15H2,1-3H3/t16?,18-,19-,20+,21?,23+,24+/m0/s1 |
| InChIKey | FZHOJNCJSFKGMI-RMOQMTKJSA-N |
| XLogP | 5.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |