C35H53NO3 — CID 67674774
phenyl 10-[(1S,3aS,3bS,5aR,9aR,9bS,11aR)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]decanoate (PubChem CID 67674774) has the molecular formula C35H53NO3 and a molecular weight of 535.81 g/mol. Its IUPAC name is phenyl 10-[(1S,3aS,3bS,5aR,9aR,9bS,11aR)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]decanoate.
| Compound Name | phenyl 10-[(1S,3aS,3bS,5aR,9aR,9bS,11aR)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]decanoate |
|---|---|
| PubChem CID | 67674774 |
| Molecular Formula | C35H53NO3 |
| Molecular Weight | 535.81 g/mol |
| Exact Mass | 535.40 |
| IUPAC Name | phenyl 10-[(1S,3aS,3bS,5aR,9aR,9bS,11aR)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]decanoate |
| SMILES | CN1C(=O)CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](CCCCCCCCCC(=O)Oc5ccccc5)CC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C35H53NO3/c1-34-24-22-30-28(19-21-31-35(30,2)25-23-32(37)36(31)3)29(34)20-18-26(34)14-10-7-5-4-6-8-13-17-33(38)39-27-15-11-9-12-16-27/h9,11-12,15-16,26,28-31H,4-8,10,13-14,17-25H2,1-3H3/t26-,28-,29-,30-,31+,34+,35+/m0/s1 |
| InChIKey | PYKOPXHQYBDZDG-JZIKLQPGSA-N |
| XLogP | 8.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.81 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|