C30H46N2O2S — CID 67675427
7-[(3aS,3bS,9aR,9bR,11aR)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-N-thiophen-2-ylheptanamide (PubChem CID 67675427) has the molecular formula C30H46N2O2S and a molecular weight of 498.78 g/mol. Its IUPAC name is 7-[(3aS,3bS,9aR,9bR,11aR)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-N-thiophen-2-ylheptanamide.
| Compound Name | 7-[(3aS,3bS,9aR,9bR,11aR)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-N-thiophen-2-ylheptanamide |
|---|---|
| PubChem CID | 67675427 |
| Molecular Formula | C30H46N2O2S |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 7-[(3aS,3bS,9aR,9bR,11aR)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-N-thiophen-2-ylheptanamide |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(CCCCCCC(=O)Nc3cccs3)CC[C@@H]12 |
| InChI | InChI=1S/C30H46N2O2S/c1-29-18-16-24-22(13-15-25-30(24,2)19-17-28(34)32(25)3)23(29)14-12-21(29)9-6-4-5-7-10-26(33)31-27-11-8-20-35-27/h8,11,20-25H,4-7,9-10,12-19H2,1-3H3,(H,31,33)/t21?,22-,23-,24+,25?,29+,30+/m0/s1 |
| InChIKey | GDWYPXTWTJAEDD-IOCVCPCQSA-N |
| XLogP | 7.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|