C27H39N3O2 — CID 22871992
1-[[(3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl]-3-phenylurea (PubChem CID 22871992) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-[[(3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[(3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 22871992 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 1-[[(3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl]-3-phenylurea |
| SMILES | CN1C(=O)CC[C@]2(C)[C@H]3CC[C@]4(C)C(CNC(=O)Nc5ccccc5)CC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C27H39N3O2/c1-26-15-13-22-20(10-12-23-27(22,2)16-14-24(31)30(23)3)21(26)11-9-18(26)17-28-25(32)29-19-7-5-4-6-8-19/h4-8,18,20-23H,9-17H2,1-3H3,(H2,28,29,32)/t18?,20-,21-,22-,23+,26+,27+/m0/s1 |
| InChIKey | FEYQHTRDSGJXEG-DETJOVKOSA-N |
| XLogP | 5.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |