C29H51N3O2 — CID 57224436
1-[[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl]-3-octylurea (PubChem CID 57224436) has the molecular formula C29H51N3O2 and a molecular weight of 473.75 g/mol. Its IUPAC name is 1-[[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl]-3-octylurea.
| Compound Name | 1-[[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl]-3-octylurea |
|---|---|
| PubChem CID | 57224436 |
| Molecular Formula | C29H51N3O2 |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.40 |
| IUPAC Name | 1-[[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl]-3-octylurea |
| SMILES | CCCCCCCCNC(=O)NCC1CC[C@H]2[C@@H]3CCC4N(C)C(=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C29H51N3O2/c1-5-6-7-8-9-10-19-30-27(34)31-20-21-11-13-23-22-12-14-25-29(3,18-16-26(33)32(25)4)24(22)15-17-28(21,23)2/h21-25H,5-20H2,1-4H3,(H2,30,31,34)/t21?,22-,23-,24+,25?,28+,29+/m0/s1 |
| InChIKey | ADBQWNUZFUUASL-RNQLQXTCSA-N |
| XLogP | 6.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|