C25H35NO2S — CID 67676435
(1R,3aS,3bS,9aR,9bS,11aR)-6,9a,11a-trimethyl-1-(2-oxo-2-thiophen-2-ylethyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 67676435) has the molecular formula C25H35NO2S and a molecular weight of 413.63 g/mol. Its IUPAC name is (1R,3aS,3bS,9aR,9bS,11aR)-6,9a,11a-trimethyl-1-(2-oxo-2-thiophen-2-ylethyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (1R,3aS,3bS,9aR,9bS,11aR)-6,9a,11a-trimethyl-1-(2-oxo-2-thiophen-2-ylethyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 67676435 |
| Molecular Formula | C25H35NO2S |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (1R,3aS,3bS,9aR,9bS,11aR)-6,9a,11a-trimethyl-1-(2-oxo-2-thiophen-2-ylethyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@H]1[C@@H]3CC[C@H](CC(=O)c4cccs4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C25H35NO2S/c1-24-12-10-19-17(7-9-22-25(19,2)13-11-23(28)26(22)3)18(24)8-6-16(24)15-20(27)21-5-4-14-29-21/h4-5,14,16-19,22H,6-13,15H2,1-3H3/t16-,17+,18+,19+,22?,24-,25-/m1/s1 |
| InChIKey | BQYNHSUOBWLNSL-RVYJXHKRSA-N |
| XLogP | 5.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |