C18H24NO+ — CID 10409825
(4S)-3-methyl-2-[(1S)-1-methyl-4H-naphthalen-1-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazol-3-ium (PubChem CID 10409825) has the molecular formula C18H24NO+ and a molecular weight of 270.40 g/mol. Its IUPAC name is (4S)-3-methyl-2-[(1S)-1-methyl-4H-naphthalen-1-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazol-3-ium.
| Compound Name | (4S)-3-methyl-2-[(1S)-1-methyl-4H-naphthalen-1-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 10409825 |
| Molecular Formula | C18H24NO+ |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | (4S)-3-methyl-2-[(1S)-1-methyl-4H-naphthalen-1-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazol-3-ium |
| SMILES | CC(C)[C@H]1COC([C@@]2(C)C=CCc3ccccc32)=[N+]1C |
| InChI | InChI=1S/C18H24NO/c1-13(2)16-12-20-17(19(16)4)18(3)11-7-9-14-8-5-6-10-15(14)18/h5-8,10-11,13,16H,9,12H2,1-4H3/q+1/t16-,18+/m1/s1 |
| InChIKey | FZNPZDCRAQWBGX-AEFFLSMTSA-N |
| XLogP | 3.15 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|