C21H25NO — CID 11426795
(4S)-4-tert-butyl-2-(1,1-diphenylethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 11426795) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2-(1,1-diphenylethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-tert-butyl-2-(1,1-diphenylethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11426795 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (4S)-4-tert-butyl-2-(1,1-diphenylethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C1=N[C@@H](C(C)(C)C)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO/c1-20(2,3)18-15-23-19(22-18)21(4,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,18H,15H2,1-4H3/t18-/m1/s1 |
| InChIKey | JPSYKTOHINGAGP-GOSISDBHSA-N |
| XLogP | 4.84 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |