C24H23ClN2O3 — CID 1041037
4-chloro-N-(2,3-dimethylphenyl)-3-[[(2S)-2-phenoxypropanoyl]amino]benzamide (PubChem CID 1041037) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dimethylphenyl)-3-[[(2S)-2-phenoxypropanoyl]amino]benzamide.
| Compound Name | 4-chloro-N-(2,3-dimethylphenyl)-3-[[(2S)-2-phenoxypropanoyl]amino]benzamide |
|---|---|
| PubChem CID | 1041037 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-chloro-N-(2,3-dimethylphenyl)-3-[[(2S)-2-phenoxypropanoyl]amino]benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(Cl)c(NC(=O)[C@H](C)Oc3ccccc3)c2)c1C |
| InChI | InChI=1S/C24H23ClN2O3/c1-15-8-7-11-21(16(15)2)26-24(29)18-12-13-20(25)22(14-18)27-23(28)17(3)30-19-9-5-4-6-10-19/h4-14,17H,1-3H3,(H,26,29)(H,27,28)/t17-/m0/s1 |
| InChIKey | TWWLOKISSDKWPI-KRWDZBQOSA-N |
| XLogP | 5.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |