C20H18N2O7S — CID 10410425
(2S)-2-[(3-acetamido-2-oxochromen-6-yl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 10410425) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is (2S)-2-[(3-acetamido-2-oxochromen-6-yl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(3-acetamido-2-oxochromen-6-yl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10410425 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (2S)-2-[(3-acetamido-2-oxochromen-6-yl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | CC(=O)Nc1cc2cc(S(=O)(=O)N[C@@H](Cc3ccccc3)C(=O)O)ccc2oc1=O |
| InChI | InChI=1S/C20H18N2O7S/c1-12(23)21-17-11-14-10-15(7-8-18(14)29-20(17)26)30(27,28)22-16(19(24)25)9-13-5-3-2-4-6-13/h2-8,10-11,16,22H,9H2,1H3,(H,21,23)(H,24,25)/t16-/m0/s1 |
| InChIKey | LBAUYGHGRHPYMI-INIZCTEOSA-N |
| XLogP | 1.73 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|