C17H15NO5S — CID 154780512
2-(1-benzofuran-2-ylsulfonylamino)-3-phenylpropanoic acid (PubChem CID 154780512) has the molecular formula C17H15NO5S and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-(1-benzofuran-2-ylsulfonylamino)-3-phenylpropanoic acid.
| Compound Name | 2-(1-benzofuran-2-ylsulfonylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 154780512 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-(1-benzofuran-2-ylsulfonylamino)-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)NS(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H15NO5S/c19-17(20)14(10-12-6-2-1-3-7-12)18-24(21,22)16-11-13-8-4-5-9-15(13)23-16/h1-9,11,14,18H,10H2,(H,19,20) |
| InChIKey | WXKYYEXAFJCVKX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |