C25H27N3O2S — CID 10410627
S-[1-[(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)amino]-1-oxopropan-2-yl] benzenecarbothioate (PubChem CID 10410627) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is S-[1-[(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)amino]-1-oxopropan-2-yl] benzenecarbothioate.
| Compound Name | S-[1-[(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)amino]-1-oxopropan-2-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 10410627 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | S-[1-[(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)amino]-1-oxopropan-2-yl] benzenecarbothioate |
| SMILES | CC(SC(=O)c1ccccc1)C(=O)NC1CC2c3cccc4[nH]cc(c34)CC2N(C)C1 |
| InChI | InChI=1S/C25H27N3O2S/c1-15(31-25(30)16-7-4-3-5-8-16)24(29)27-18-12-20-19-9-6-10-21-23(19)17(13-26-21)11-22(20)28(2)14-18/h3-10,13,15,18,20,22,26H,11-12,14H2,1-2H3,(H,27,29) |
| InChIKey | UDSVBOPXCHCICQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|