C25H30ClN5 — CID 10410746
4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]-N-cyclohexylcyclohexan-1-amine (PubChem CID 10410746) has the molecular formula C25H30ClN5 and a molecular weight of 436.00 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]-N-cyclohexylcyclohexan-1-amine.
| Compound Name | 4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]-N-cyclohexylcyclohexan-1-amine |
|---|---|
| PubChem CID | 10410746 |
| Molecular Formula | C25H30ClN5 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]-N-cyclohexylcyclohexan-1-amine |
| SMILES | Clc1ccc(-c2n[nH]c(C3CCC(NC4CCCCC4)CC3)c2-c2ccncn2)cc1 |
| InChI | InChI=1S/C25H30ClN5/c26-19-10-6-17(7-11-19)24-23(22-14-15-27-16-28-22)25(31-30-24)18-8-12-21(13-9-18)29-20-4-2-1-3-5-20/h6-7,10-11,14-16,18,20-21,29H,1-5,8-9,12-13H2,(H,30,31) |
| InChIKey | SYDRAMVHCGHABX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |