C26H31NO5 — CID 10410831
(4-nitrophenyl) (1R,4aS,9R,10aR)-9-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 10410831) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (4-nitrophenyl) (1R,4aS,9R,10aR)-9-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | (4-nitrophenyl) (1R,4aS,9R,10aR)-9-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 10410831 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (4-nitrophenyl) (1R,4aS,9R,10aR)-9-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | CC(C)c1ccc2c(c1)[C@H](O)C[C@H]1[C@](C)(C(=O)Oc3ccc([N+](=O)[O-])cc3)CCC[C@]21C |
| InChI | InChI=1S/C26H31NO5/c1-16(2)17-6-11-21-20(14-17)22(28)15-23-25(21,3)12-5-13-26(23,4)24(29)32-19-9-7-18(8-10-19)27(30)31/h6-11,14,16,22-23,28H,5,12-13,15H2,1-4H3/t22-,23-,25-,26-/m1/s1 |
| InChIKey | BQLTUQYMBOALHS-OQUNMALSSA-N |
| XLogP | 5.82 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|