C15H10Cl2N6O4S — CID 10411019
N,2-bis(4-chloro-2-nitrophenyl)-5-methylsulfanyl-1,2,4-triazol-3-amine (PubChem CID 10411019) has the molecular formula C15H10Cl2N6O4S and a molecular weight of 441.26 g/mol. Its IUPAC name is N,2-bis(4-chloro-2-nitrophenyl)-5-methylsulfanyl-1,2,4-triazol-3-amine.
| Compound Name | N,2-bis(4-chloro-2-nitrophenyl)-5-methylsulfanyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 10411019 |
| Molecular Formula | C15H10Cl2N6O4S |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | N,2-bis(4-chloro-2-nitrophenyl)-5-methylsulfanyl-1,2,4-triazol-3-amine |
| SMILES | CSc1nc(Nc2ccc(Cl)cc2[N+](=O)[O-])n(-c2ccc(Cl)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H10Cl2N6O4S/c1-28-15-19-14(18-10-4-2-8(16)6-12(10)22(24)25)21(20-15)11-5-3-9(17)7-13(11)23(26)27/h2-7H,1H3,(H,18,19,20) |
| InChIKey | FXCCQWHDCNYSLR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|