C18H15ClF2N4O3 — CID 142521651
N-(4-chloro-2-nitrophenyl)-4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine (PubChem CID 142521651) has the molecular formula C18H15ClF2N4O3 and a molecular weight of 408.79 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine.
| Compound Name | N-(4-chloro-2-nitrophenyl)-4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine |
|---|---|
| PubChem CID | 142521651 |
| Molecular Formula | C18H15ClF2N4O3 |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine |
| SMILES | COc1cc(F)c(-c2c(C)nn(C)c2Nc2ccc(Cl)cc2[N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C18H15ClF2N4O3/c1-9-16(17-12(20)7-11(28-3)8-13(17)21)18(24(2)23-9)22-14-5-4-10(19)6-15(14)25(26)27/h4-8,22H,1-3H3 |
| InChIKey | LJYITVPKZFBWJV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|