C18H16ClFN4O3 — CID 137458665
4-(2-chloro-4-fluorophenyl)-N-(4-methoxy-2-nitrophenyl)-1,3-dimethylpyrazol-5-amine (PubChem CID 137458665) has the molecular formula C18H16ClFN4O3 and a molecular weight of 390.80 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)-N-(4-methoxy-2-nitrophenyl)-1,3-dimethylpyrazol-5-amine.
| Compound Name | 4-(2-chloro-4-fluorophenyl)-N-(4-methoxy-2-nitrophenyl)-1,3-dimethylpyrazol-5-amine |
|---|---|
| PubChem CID | 137458665 |
| Molecular Formula | C18H16ClFN4O3 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)-N-(4-methoxy-2-nitrophenyl)-1,3-dimethylpyrazol-5-amine |
| SMILES | COc1ccc(Nc2c(-c3ccc(F)cc3Cl)c(C)nn2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16ClFN4O3/c1-10-17(13-6-4-11(20)8-14(13)19)18(23(2)22-10)21-15-7-5-12(27-3)9-16(15)24(25)26/h4-9,21H,1-3H3 |
| InChIKey | RMYGCBNFIUABNV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|