C18H18ClFN4O — CID 137458410
1-N-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]-4-methoxybenzene-1,2-diamine (PubChem CID 137458410) has the molecular formula C18H18ClFN4O and a molecular weight of 360.82 g/mol. Its IUPAC name is 1-N-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]-4-methoxybenzene-1,2-diamine.
| Compound Name | 1-N-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]-4-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 137458410 |
| Molecular Formula | C18H18ClFN4O |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-N-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]-4-methoxybenzene-1,2-diamine |
| SMILES | COc1ccc(Nc2c(-c3ccc(F)cc3Cl)c(C)nn2C)c(N)c1 |
| InChI | InChI=1S/C18H18ClFN4O/c1-10-17(13-6-4-11(20)8-14(13)19)18(24(2)23-10)22-16-7-5-12(25-3)9-15(16)21/h4-9,22H,21H2,1-3H3 |
| InChIKey | WCIFBEPMHAISEO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|