C18H17ClF2N4O — CID 137458325
3-chloro-2-N-[4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-yl]benzene-1,2-diamine (PubChem CID 137458325) has the molecular formula C18H17ClF2N4O and a molecular weight of 378.81 g/mol. Its IUPAC name is 3-chloro-2-N-[4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-yl]benzene-1,2-diamine.
| Compound Name | 3-chloro-2-N-[4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 137458325 |
| Molecular Formula | C18H17ClF2N4O |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-chloro-2-N-[4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-yl]benzene-1,2-diamine |
| SMILES | COc1cc(F)c(-c2c(C)nn(C)c2Nc2c(N)cccc2Cl)c(F)c1 |
| InChI | InChI=1S/C18H17ClF2N4O/c1-9-15(16-12(20)7-10(26-3)8-13(16)21)18(25(2)24-9)23-17-11(19)5-4-6-14(17)22/h4-8,23H,22H2,1-3H3 |
| InChIKey | PTALDMNESKOPIC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|