C12H16N4O — CID 43554187
5-N-(3-methoxyphenyl)-1,3-dimethylpyrazole-4,5-diamine (PubChem CID 43554187) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 5-N-(3-methoxyphenyl)-1,3-dimethylpyrazole-4,5-diamine.
| Compound Name | 5-N-(3-methoxyphenyl)-1,3-dimethylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 43554187 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 5-N-(3-methoxyphenyl)-1,3-dimethylpyrazole-4,5-diamine |
| SMILES | COc1cccc(Nc2c(N)c(C)nn2C)c1 |
| InChI | InChI=1S/C12H16N4O/c1-8-11(13)12(16(2)15-8)14-9-5-4-6-10(7-9)17-3/h4-7,14H,13H2,1-3H3 |
| InChIKey | LSEXYKGDDFGHMZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |