C14H15ClN2O2 — CID 43148696
3-chloro-2-N-(3,5-dimethoxyphenyl)benzene-1,2-diamine (PubChem CID 43148696) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 3-chloro-2-N-(3,5-dimethoxyphenyl)benzene-1,2-diamine.
| Compound Name | 3-chloro-2-N-(3,5-dimethoxyphenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43148696 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-chloro-2-N-(3,5-dimethoxyphenyl)benzene-1,2-diamine |
| SMILES | COc1cc(Nc2c(N)cccc2Cl)cc(OC)c1 |
| InChI | InChI=1S/C14H15ClN2O2/c1-18-10-6-9(7-11(8-10)19-2)17-14-12(15)4-3-5-13(14)16/h3-8,17H,16H2,1-2H3 |
| InChIKey | OMAVBNCCUICDIR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|