C13H15F2N3 — CID 140655069
4-(2,6-difluorophenyl)-N-ethyl-1,3-dimethylpyrazol-5-amine (PubChem CID 140655069) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-N-ethyl-1,3-dimethylpyrazol-5-amine.
| Compound Name | 4-(2,6-difluorophenyl)-N-ethyl-1,3-dimethylpyrazol-5-amine |
|---|---|
| PubChem CID | 140655069 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(2,6-difluorophenyl)-N-ethyl-1,3-dimethylpyrazol-5-amine |
| SMILES | CCNc1c(-c2c(F)cccc2F)c(C)nn1C |
| InChI | InChI=1S/C13H15F2N3/c1-4-16-13-11(8(2)17-18(13)3)12-9(14)6-5-7-10(12)15/h5-7,16H,4H2,1-3H3 |
| InChIKey | FEAPAMRCBJVJGF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |