C18H14BrF3N4O3 — CID 137458710
N-(4-bromo-2-fluoro-6-nitrophenyl)-4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine (PubChem CID 137458710) has the molecular formula C18H14BrF3N4O3 and a molecular weight of 471.23 g/mol. Its IUPAC name is N-(4-bromo-2-fluoro-6-nitrophenyl)-4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine.
| Compound Name | N-(4-bromo-2-fluoro-6-nitrophenyl)-4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine |
|---|---|
| PubChem CID | 137458710 |
| Molecular Formula | C18H14BrF3N4O3 |
| Molecular Weight | 471.23 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | N-(4-bromo-2-fluoro-6-nitrophenyl)-4-(2,6-difluoro-4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine |
| SMILES | COc1cc(F)c(-c2c(C)nn(C)c2Nc2c(F)cc(Br)cc2[N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C18H14BrF3N4O3/c1-8-15(16-11(20)6-10(29-3)7-12(16)21)18(25(2)24-8)23-17-13(22)4-9(19)5-14(17)26(27)28/h4-7,23H,1-3H3 |
| InChIKey | YXJPLHMEFVNZGL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.23 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|