C22H28N4O4S — CID 10411208
6-cyclopentyl-3-(1-ethyltetrazol-5-yl)sulfanyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 10411208) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 6-cyclopentyl-3-(1-ethyltetrazol-5-yl)sulfanyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-(1-ethyltetrazol-5-yl)sulfanyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 10411208 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 6-cyclopentyl-3-(1-ethyltetrazol-5-yl)sulfanyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | CCn1nnnc1SC1C(=O)CC(CCc2ccc(OC)cc2)(C2CCCC2)OC1=O |
| InChI | InChI=1S/C22H28N4O4S/c1-3-26-21(23-24-25-26)31-19-18(27)14-22(30-20(19)28,16-6-4-5-7-16)13-12-15-8-10-17(29-2)11-9-15/h8-11,16,19H,3-7,12-14H2,1-2H3 |
| InChIKey | LUZDIUDJSLCSJE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|