C21H26N4O4S — CID 90687065
3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 90687065) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 90687065 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3n[nH]c(N)n3)C(=O)O2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-28-15-8-6-13(7-9-15)10-11-21(14-4-2-3-5-14)12-16(26)17(18(27)29-21)30-20-23-19(22)24-25-20/h6-9,14,17H,2-5,10-12H2,1H3,(H3,22,23,24,25) |
| InChIKey | DZJFZIDUJUBZIO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|