C21H24ClN3O4S — CID 10433871
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)oxane-2,4-dione (PubChem CID 10433871) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 10433871 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3ncn[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C21H24ClN3O4S/c1-28-17-7-6-13(10-15(17)22)8-9-21(14-4-2-3-5-14)11-16(26)18(19(27)29-21)30-20-23-12-24-25-20/h6-7,10,12,14,18H,2-5,8-9,11H2,1H3,(H,23,24,25) |
| InChIKey | GLVYNEGOHMANQE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|