C23H28ClN3O4S — CID 91436584
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione (PubChem CID 91436584) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91436584 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
| SMILES | CCn1cnnc1SC1C(=O)CC(CCc2ccc(OC)c(Cl)c2)(C2CCCC2)OC1=O |
| InChI | InChI=1S/C23H28ClN3O4S/c1-3-27-14-25-26-22(27)32-20-18(28)13-23(31-21(20)29,16-6-4-5-7-16)11-10-15-8-9-19(30-2)17(24)12-15/h8-9,12,14,16,20H,3-7,10-11,13H2,1-2H3 |
| InChIKey | JMZVDCIFXUWDDG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|