C29H48O3 — CID 10411226
(1S,2R,5S,9S,10S,15R,16R)-15-[(5R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-11-ene-5,10-diol (PubChem CID 10411226) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (1S,2R,5S,9S,10S,15R,16R)-15-[(5R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-11-ene-5,10-diol.
| Compound Name | (1S,2R,5S,9S,10S,15R,16R)-15-[(5R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-11-ene-5,10-diol |
|---|---|
| PubChem CID | 10411226 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (1S,2R,5S,9S,10S,15R,16R)-15-[(5R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-11-ene-5,10-diol |
| SMILES | CCC(CCC(C)[C@H]1CCC2=C3[C@H](O)[C@@H]4OC45C[C@@H](O)CC[C@]5(C)[C@H]3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C29H48O3/c1-7-19(17(2)3)9-8-18(4)21-10-11-22-24-23(13-14-27(21,22)5)28(6)15-12-20(30)16-29(28)26(32-29)25(24)31/h17-21,23,25-26,30-31H,7-16H2,1-6H3/t18?,19?,20-,21+,23-,25-,26-,27+,28+,29?/m0/s1 |
| InChIKey | LDTVSAVVGTWARS-BWJYUYLUSA-N |
| XLogP | 6.27 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|