C31H48O5 — CID 15249370
[(1S,2R,5S,7R,9S,10S,15R,16R)-10-acetyloxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-11-en-5-yl] acetate (PubChem CID 15249370) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is [(1S,2R,5S,7R,9S,10S,15R,16R)-10-acetyloxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-11-en-5-yl] acetate.
| Compound Name | [(1S,2R,5S,7R,9S,10S,15R,16R)-10-acetyloxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-11-en-5-yl] acetate |
|---|---|
| PubChem CID | 15249370 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | [(1S,2R,5S,7R,9S,10S,15R,16R)-10-acetyloxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-11-en-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@@]4(C)C(=C3[C@H](OC(C)=O)[C@@H]3O[C@@]32C1)CC[C@@H]4[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C31H48O5/c1-18(2)9-8-10-19(3)23-11-12-24-26-25(14-15-29(23,24)6)30(7)16-13-22(34-20(4)32)17-31(30)28(36-31)27(26)35-21(5)33/h18-19,22-23,25,27-28H,8-17H2,1-7H3/t19-,22+,23-,25+,27+,28+,29-,30-,31+/m1/s1 |
| InChIKey | MUCPRTGNBQKRHP-MAJCZAPQSA-N |
| XLogP | 6.78 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|