C29H46O4 — CID 102469208
[(1R,3S,4R,6S,8S,11R,12R,15R,16R,19R)-11,15-dimethyl-16-[(2R)-6-methylheptan-2-yl]-2,5-dioxahexacyclo[10.7.0.01,3.04,6.06,11.015,19]nonadecan-8-yl] acetate (PubChem CID 102469208) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is [(1R,3S,4R,6S,8S,11R,12R,15R,16R,19R)-11,15-dimethyl-16-[(2R)-6-methylheptan-2-yl]-2,5-dioxahexacyclo[10.7.0.01,3.04,6.06,11.015,19]nonadecan-8-yl] acetate.
| Compound Name | [(1R,3S,4R,6S,8S,11R,12R,15R,16R,19R)-11,15-dimethyl-16-[(2R)-6-methylheptan-2-yl]-2,5-dioxahexacyclo[10.7.0.01,3.04,6.06,11.015,19]nonadecan-8-yl] acetate |
|---|---|
| PubChem CID | 102469208 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | [(1R,3S,4R,6S,8S,11R,12R,15R,16R,19R)-11,15-dimethyl-16-[(2R)-6-methylheptan-2-yl]-2,5-dioxahexacyclo[10.7.0.01,3.04,6.06,11.015,19]nonadecan-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]4[C@@]34O[C@H]4[C@H]3O[C@]32C1 |
| InChI | InChI=1S/C29H46O4/c1-17(2)8-7-9-18(3)21-10-11-22-26(21,5)14-13-23-27(6)15-12-20(31-19(4)30)16-28(27)24(32-28)25-29(22,23)33-25/h17-18,20-25H,7-16H2,1-6H3/t18-,20+,21-,22-,23-,24-,25+,26-,27-,28-,29-/m1/s1 |
| InChIKey | FDRLRWUREJAUGE-YGBGDHCVSA-N |
| XLogP | 6.30 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|