C28H44O5 — CID 58114872
[(1R,2R,5R,6R,9R,10R,13S,15R)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-16-oxo-17,18-dioxapentacyclo[13.2.1.01,9.02,6.010,15]octadecan-13-yl] acetate (PubChem CID 58114872) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is [(1R,2R,5R,6R,9R,10R,13S,15R)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-16-oxo-17,18-dioxapentacyclo[13.2.1.01,9.02,6.010,15]octadecan-13-yl] acetate.
| Compound Name | [(1R,2R,5R,6R,9R,10R,13S,15R)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-16-oxo-17,18-dioxapentacyclo[13.2.1.01,9.02,6.010,15]octadecan-13-yl] acetate |
|---|---|
| PubChem CID | 58114872 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [(1R,2R,5R,6R,9R,10R,13S,15R)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-16-oxo-17,18-dioxapentacyclo[13.2.1.01,9.02,6.010,15]octadecan-13-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]4[C@@]34OC(=O)[C@]2(C1)O4 |
| InChI | InChI=1S/C28H44O5/c1-17(2)8-7-9-18(3)21-10-11-22-25(21,5)14-13-23-26(6)15-12-20(31-19(4)29)16-27(26)24(30)32-28(22,23)33-27/h17-18,20-23H,7-16H2,1-6H3/t18-,20+,21-,22-,23-,25-,26-,27+,28+/m1/s1 |
| InChIKey | YOZQLCQOEYKKNP-CLBGIHHBSA-N |
| XLogP | 6.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |