C27H42O5 — CID 67819609
[(1R,5S,6R,10R,13S,15R)-6,10-dimethyl-5-(5-methylhexyl)-16-oxo-17,18-dioxapentacyclo[13.2.1.01,9.02,6.010,15]octadecan-13-yl] acetate (PubChem CID 67819609) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is [(1R,5S,6R,10R,13S,15R)-6,10-dimethyl-5-(5-methylhexyl)-16-oxo-17,18-dioxapentacyclo[13.2.1.01,9.02,6.010,15]octadecan-13-yl] acetate.
| Compound Name | [(1R,5S,6R,10R,13S,15R)-6,10-dimethyl-5-(5-methylhexyl)-16-oxo-17,18-dioxapentacyclo[13.2.1.01,9.02,6.010,15]octadecan-13-yl] acetate |
|---|---|
| PubChem CID | 67819609 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | [(1R,5S,6R,10R,13S,15R)-6,10-dimethyl-5-(5-methylhexyl)-16-oxo-17,18-dioxapentacyclo[13.2.1.01,9.02,6.010,15]octadecan-13-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C3CC[C@@]4(C)C(CC[C@@H]4CCCCC(C)C)[C@@]34OC(=O)[C@]2(C1)O4 |
| InChI | InChI=1S/C27H42O5/c1-17(2)8-6-7-9-19-10-11-21-24(19,4)14-13-22-25(5)15-12-20(30-18(3)28)16-26(25)23(29)31-27(21,22)32-26/h17,19-22H,6-16H2,1-5H3/t19-,20-,21?,22?,24+,25+,26-,27-/m0/s1 |
| InChIKey | OECNWUWBEVYPER-CQJNTXBUSA-N |
| XLogP | 5.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|