C22H28N4O5S — CID 10411933
tert-butyl (3R)-3-(prop-2-enylcarbamoyl)-4-quinolin-8-ylsulfonylpiperazine-1-carboxylate (PubChem CID 10411933) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is tert-butyl (3R)-3-(prop-2-enylcarbamoyl)-4-quinolin-8-ylsulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(prop-2-enylcarbamoyl)-4-quinolin-8-ylsulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 10411933 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | tert-butyl (3R)-3-(prop-2-enylcarbamoyl)-4-quinolin-8-ylsulfonylpiperazine-1-carboxylate |
| SMILES | C=CCNC(=O)[C@H]1CN(C(=O)OC(C)(C)C)CCN1S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C22H28N4O5S/c1-5-11-24-20(27)17-15-25(21(28)31-22(2,3)4)13-14-26(17)32(29,30)18-10-6-8-16-9-7-12-23-19(16)18/h5-10,12,17H,1,11,13-15H2,2-4H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | SNPHGUNHXYJXCW-QGZVFWFLSA-N |
| XLogP | 2.15 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|