C17H20N4O3S — CID 10247960
(2R)-N-prop-2-enyl-1-quinolin-8-ylsulfonylpiperazine-2-carboxamide (PubChem CID 10247960) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is (2R)-N-prop-2-enyl-1-quinolin-8-ylsulfonylpiperazine-2-carboxamide.
| Compound Name | (2R)-N-prop-2-enyl-1-quinolin-8-ylsulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 10247960 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2R)-N-prop-2-enyl-1-quinolin-8-ylsulfonylpiperazine-2-carboxamide |
| SMILES | C=CCNC(=O)[C@H]1CNCCN1S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C17H20N4O3S/c1-2-8-20-17(22)14-12-18-10-11-21(14)25(23,24)15-7-3-5-13-6-4-9-19-16(13)15/h2-7,9,14,18H,1,8,10-12H2,(H,20,22)/t14-/m1/s1 |
| InChIKey | LBAYQNFLLCPRPJ-CQSZACIVSA-N |
| XLogP | 0.50 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|