C23H30N4O4S — CID 110201482
5-[(2S)-1-quinolin-8-ylsulfonylpyrrolidine-2-carbonyl]-1,5-diazacycloundecan-2-one (PubChem CID 110201482) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is 5-[(2S)-1-quinolin-8-ylsulfonylpyrrolidine-2-carbonyl]-1,5-diazacycloundecan-2-one.
| Compound Name | 5-[(2S)-1-quinolin-8-ylsulfonylpyrrolidine-2-carbonyl]-1,5-diazacycloundecan-2-one |
|---|---|
| PubChem CID | 110201482 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 5-[(2S)-1-quinolin-8-ylsulfonylpyrrolidine-2-carbonyl]-1,5-diazacycloundecan-2-one |
| SMILES | O=C1CCN(C(=O)[C@@H]2CCCN2S(=O)(=O)c2cccc3cccnc23)CCCCCCN1 |
| InChI | InChI=1S/C23H30N4O4S/c28-21-12-17-26(15-4-2-1-3-13-24-21)23(29)19-10-7-16-27(19)32(30,31)20-11-5-8-18-9-6-14-25-22(18)20/h5-6,8-9,11,14,19H,1-4,7,10,12-13,15-17H2,(H,24,28)/t19-/m0/s1 |
| InChIKey | WRNLMDBIJAXRRE-IBGZPJMESA-N |
| XLogP | 2.30 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |