C19H17FN2O2S — CID 2738249
8-[2-(4-fluorophenyl)pyrrolidin-1-yl]sulfonylquinoline (PubChem CID 2738249) has the molecular formula C19H17FN2O2S and a molecular weight of 356.42 g/mol. Its IUPAC name is 8-[2-(4-fluorophenyl)pyrrolidin-1-yl]sulfonylquinoline.
| Compound Name | 8-[2-(4-fluorophenyl)pyrrolidin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 2738249 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 8-[2-(4-fluorophenyl)pyrrolidin-1-yl]sulfonylquinoline |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O2S/c20-16-10-8-14(9-11-16)17-6-3-13-22(17)25(23,24)18-7-1-4-15-5-2-12-21-19(15)18/h1-2,4-5,7-12,17H,3,6,13H2 |
| InChIKey | PVRIFDUVNFYWRJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |