C27H22F2N2O3S — CID 91602279
2-[bis(4-fluorophenyl)methyl]-1-quinolin-8-ylsulfonylpiperidin-4-one (PubChem CID 91602279) has the molecular formula C27H22F2N2O3S and a molecular weight of 492.55 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methyl]-1-quinolin-8-ylsulfonylpiperidin-4-one.
| Compound Name | 2-[bis(4-fluorophenyl)methyl]-1-quinolin-8-ylsulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 91602279 |
| Molecular Formula | C27H22F2N2O3S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methyl]-1-quinolin-8-ylsulfonylpiperidin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2cccc3cccnc23)C(C(c2ccc(F)cc2)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H22F2N2O3S/c28-21-10-6-18(7-11-21)26(19-8-12-22(29)13-9-19)24-17-23(32)14-16-31(24)35(33,34)25-5-1-3-20-4-2-15-30-27(20)25/h1-13,15,24,26H,14,16-17H2 |
| InChIKey | FWSPCLJIWUXENI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |