C17H19N6O6PS — CID 10412220
2-(2-aminophenyl)sulfanyl-9-(2-hydroxy-7-methoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-amine (PubChem CID 10412220) has the molecular formula C17H19N6O6PS and a molecular weight of 466.42 g/mol. Its IUPAC name is 2-(2-aminophenyl)sulfanyl-9-(2-hydroxy-7-methoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-amine.
| Compound Name | 2-(2-aminophenyl)sulfanyl-9-(2-hydroxy-7-methoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-amine |
|---|---|
| PubChem CID | 10412220 |
| Molecular Formula | C17H19N6O6PS |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 2-(2-aminophenyl)sulfanyl-9-(2-hydroxy-7-methoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-amine |
| SMILES | COC1C2OP(=O)(O)OCC2OC1n1cnc2c(N)nc(Sc3ccccc3N)nc21 |
| InChI | InChI=1S/C17H19N6O6PS/c1-26-13-12-9(6-27-30(24,25)29-12)28-16(13)23-7-20-11-14(19)21-17(22-15(11)23)31-10-5-3-2-4-8(10)18/h2-5,7,9,12-13,16H,6,18H2,1H3,(H,24,25)(H2,19,21,22) |
| InChIKey | BNBAUGGYRFJNHL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 169.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|