C34H55NO4SSi — CID 10416161
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (3R)-3-[dimethyl(phenyl)silyl]butanoate (PubChem CID 10416161) has the molecular formula C34H55NO4SSi and a molecular weight of 601.97 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (3R)-3-[dimethyl(phenyl)silyl]butanoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (3R)-3-[dimethyl(phenyl)silyl]butanoate |
|---|---|
| PubChem CID | 10416161 |
| Molecular Formula | C34H55NO4SSi |
| Molecular Weight | 601.97 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (3R)-3-[dimethyl(phenyl)silyl]butanoate |
| SMILES | C[C@H](CC(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C34H55NO4SSi/c1-26(41(4,5)30-19-13-8-14-20-30)23-32(36)39-31-24-27-21-22-34(31,33(27,2)3)25-40(37,38)35(28-15-9-6-10-16-28)29-17-11-7-12-18-29/h8,13-14,19-20,26-29,31H,6-7,9-12,15-18,21-25H2,1-5H3/t26-,27-,31-,34-/m1/s1 |
| InChIKey | WOMZXAXNFRNOIU-MORWTMLQSA-N |
| XLogP | 7.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.97 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|