C33H51NO4SSi — CID 10077041
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-3-[dimethyl(phenyl)silyl]prop-2-enoate (PubChem CID 10077041) has the molecular formula C33H51NO4SSi and a molecular weight of 585.93 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-3-[dimethyl(phenyl)silyl]prop-2-enoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-3-[dimethyl(phenyl)silyl]prop-2-enoate |
|---|---|
| PubChem CID | 10077041 |
| Molecular Formula | C33H51NO4SSi |
| Molecular Weight | 585.93 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-3-[dimethyl(phenyl)silyl]prop-2-enoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)/C=C/[Si](C)(C)c1ccccc1)C2 |
| InChI | InChI=1S/C33H51NO4SSi/c1-32(2)26-20-22-33(32,30(24-26)38-31(35)21-23-40(3,4)29-18-12-7-13-19-29)25-39(36,37)34(27-14-8-5-9-15-27)28-16-10-6-11-17-28/h7,12-13,18-19,21,23,26-28,30H,5-6,8-11,14-17,20,22,24-25H2,1-4H3/b23-21+/t26-,30-,33-/m1/s1 |
| InChIKey | CXBINRCCYOGYBK-SYRUFDEQSA-N |
| XLogP | 6.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.93 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|