C39H57NO4SSi — CID 10372233
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (3R)-3-[dimethyl(phenyl)silyl]-3-phenylpropanoate (PubChem CID 10372233) has the molecular formula C39H57NO4SSi and a molecular weight of 664.04 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (3R)-3-[dimethyl(phenyl)silyl]-3-phenylpropanoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (3R)-3-[dimethyl(phenyl)silyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10372233 |
| Molecular Formula | C39H57NO4SSi |
| Molecular Weight | 664.04 g/mol |
| Exact Mass | 663.38 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (3R)-3-[dimethyl(phenyl)silyl]-3-phenylpropanoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)C[C@H](c1ccccc1)[Si](C)(C)c1ccccc1)C2 |
| InChI | InChI=1S/C39H57NO4SSi/c1-38(2)31-25-26-39(38,29-45(42,43)40(32-19-11-6-12-20-32)33-21-13-7-14-22-33)36(27-31)44-37(41)28-35(30-17-9-5-10-18-30)46(3,4)34-23-15-8-16-24-34/h5,8-10,15-18,23-24,31-33,35-36H,6-7,11-14,19-22,25-29H2,1-4H3/t31-,35-,36-,39-/m1/s1 |
| InChIKey | FODRLYFGKCYYES-AVFQREJJSA-N |
| XLogP | 8.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.04 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|