C38H50N2O5S — CID 101456620
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (4R,5R)-4,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 101456620) has the molecular formula C38H50N2O5S and a molecular weight of 646.89 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (4R,5R)-4,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (4R,5R)-4,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 101456620 |
| Molecular Formula | C38H50N2O5S |
| Molecular Weight | 646.89 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (4R,5R)-4,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)C1=NO[C@@H](c3ccccc3)[C@@H]1c1ccccc1)C2 |
| InChI | InChI=1S/C38H50N2O5S/c1-37(2)29-23-24-38(37,26-46(42,43)40(30-19-11-5-12-20-30)31-21-13-6-14-22-31)32(25-29)44-36(41)34-33(27-15-7-3-8-16-27)35(45-39-34)28-17-9-4-10-18-28/h3-4,7-10,15-18,29-33,35H,5-6,11-14,19-26H2,1-2H3/t29-,32-,33-,35+,38-/m1/s1 |
| InChIKey | ACRDZVANADLYFC-MPJHDRBPSA-N |
| XLogP | 7.93 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.89 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |