C34H48N2O4S — CID 10460870
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-cyano-2-phenylpent-4-enoate (PubChem CID 10460870) has the molecular formula C34H48N2O4S and a molecular weight of 580.84 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-cyano-2-phenylpent-4-enoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-cyano-2-phenylpent-4-enoate |
|---|---|
| PubChem CID | 10460870 |
| Molecular Formula | C34H48N2O4S |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-cyano-2-phenylpent-4-enoate |
| SMILES | C=CC[C@](C#N)(C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C34H48N2O4S/c1-4-21-33(24-35,26-14-8-5-9-15-26)31(37)40-30-23-27-20-22-34(30,32(27,2)3)25-41(38,39)36(28-16-10-6-11-17-28)29-18-12-7-13-19-29/h4-5,8-9,14-15,27-30H,1,6-7,10-13,16-23,25H2,2-3H3/t27-,30-,33-,34-/m1/s1 |
| InChIKey | NUIPIJDYAUAPGQ-RECOHGTRSA-N |
| XLogP | 7.06 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|