C37H51N3O6S2 — CID 10259150
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylacetate (PubChem CID 10259150) has the molecular formula C37H51N3O6S2 and a molecular weight of 697.96 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylacetate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylacetate |
|---|---|
| PubChem CID | 10259150 |
| Molecular Formula | C37H51N3O6S2 |
| Molecular Weight | 697.96 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylacetate |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(/C(=O)O[C@@H]2C[C@H]3CC[C@]2(CS(=O)(=O)N(C2CCCCC2)C2CCCCC2)C3(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H51N3O6S2/c1-27-19-21-32(22-20-27)48(44,45)39-38-34(28-13-7-4-8-14-28)35(41)46-33-25-29-23-24-37(33,36(29,2)3)26-47(42,43)40(30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4,7-8,13-14,19-22,29-31,33,39H,5-6,9-12,15-18,23-26H2,1-3H3/b38-34+/t29-,33-,37-/m1/s1 |
| InChIKey | UXDJPZIUZPLCJG-AAFAHNQESA-N |
| XLogP | 6.71 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.96 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|