C36H56N2O6S2 — CID 12061199
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-3,3-dimethyl-2-[(4-methylphenyl)sulfonylamino]pent-4-enoate (PubChem CID 12061199) has the molecular formula C36H56N2O6S2 and a molecular weight of 676.99 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-3,3-dimethyl-2-[(4-methylphenyl)sulfonylamino]pent-4-enoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-3,3-dimethyl-2-[(4-methylphenyl)sulfonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 12061199 |
| Molecular Formula | C36H56N2O6S2 |
| Molecular Weight | 676.99 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-3,3-dimethyl-2-[(4-methylphenyl)sulfonylamino]pent-4-enoate |
| SMILES | C=CC(C)(C)[C@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C |
| InChI | InChI=1S/C36H56N2O6S2/c1-7-34(3,4)32(37-46(42,43)30-20-18-26(2)19-21-30)33(39)44-31-24-27-22-23-36(31,35(27,5)6)25-45(40,41)38(28-14-10-8-11-15-28)29-16-12-9-13-17-29/h7,18-21,27-29,31-32,37H,1,8-17,22-25H2,2-6H3/t27-,31-,32-,36-/m1/s1 |
| InChIKey | ZILVDJWEQXPRLF-CGJDKJMMSA-N |
| XLogP | 6.89 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.99 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|