C32H44N2O4S — CID 14803994
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-2-cyano-3-phenylprop-2-enoate (PubChem CID 14803994) has the molecular formula C32H44N2O4S and a molecular weight of 552.78 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-2-cyano-3-phenylprop-2-enoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-2-cyano-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 14803994 |
| Molecular Formula | C32H44N2O4S |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-2-cyano-3-phenylprop-2-enoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)/C(C#N)=C/c1ccccc1)C2 |
| InChI | InChI=1S/C32H44N2O4S/c1-31(2)26-18-19-32(31,29(21-26)38-30(35)25(22-33)20-24-12-6-3-7-13-24)23-39(36,37)34(27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3,6-7,12-13,20,26-29H,4-5,8-11,14-19,21,23H2,1-2H3/b25-20+/t26-,29-,32-/m1/s1 |
| InChIKey | MQPLCLGRUNSLAY-ZIIKAXMZSA-N |
| XLogP | 6.63 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|