C28H35NO4S — CID 10005442
[(1S,2R,4R)-1-(dibenzylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-but-2-enoate (PubChem CID 10005442) has the molecular formula C28H35NO4S and a molecular weight of 481.66 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dibenzylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-but-2-enoate.
| Compound Name | [(1S,2R,4R)-1-(dibenzylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-but-2-enoate |
|---|---|
| PubChem CID | 10005442 |
| Molecular Formula | C28H35NO4S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | [(1S,2R,4R)-1-(dibenzylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-but-2-enoate |
| SMILES | C/C=C\C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(Cc1ccccc1)Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C28H35NO4S/c1-4-11-26(30)33-25-18-24-16-17-28(25,27(24,2)3)21-34(31,32)29(19-22-12-7-5-8-13-22)20-23-14-9-6-10-15-23/h4-15,24-25H,16-21H2,1-3H3/b11-4-/t24-,25-,28-/m1/s1 |
| InChIKey | DGSJJEANONLWDA-DNILRMJLSA-N |
| XLogP | 5.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|