C28H35NO4S — CID 102472941
[(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)pent-2-enoate (PubChem CID 102472941) has the molecular formula C28H35NO4S and a molecular weight of 481.66 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)pent-2-enoate.
| Compound Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)pent-2-enoate |
|---|---|
| PubChem CID | 102472941 |
| Molecular Formula | C28H35NO4S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)pent-2-enoate |
| SMILES | CC/C(=C/C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)C2(C)C)NCc1ccccc1 |
| InChI | InChI=1S/C28H35NO4S/c1-4-23(29-19-21-11-7-5-8-12-21)18-26(30)33-25-17-22-15-16-28(25,27(22,2)3)20-34(31,32)24-13-9-6-10-14-24/h5-14,18,22,25,29H,4,15-17,19-20H2,1-3H3/b23-18-/t22-,25-,28-/m1/s1 |
| InChIKey | INMAYEJFPJEMLS-DHJPSHEVSA-N |
| XLogP | 5.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|