C34H39NO4S — CID 25023308
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)-5-phenylpent-2-enoate (PubChem CID 25023308) has the molecular formula C34H39NO4S and a molecular weight of 557.76 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)-5-phenylpent-2-enoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 25023308 |
| Molecular Formula | C34H39NO4S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)-5-phenylpent-2-enoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)[C@@H](OC(=O)/C=C(/CCc1ccccc1)NCc1ccccc1)C2 |
| InChI | InChI=1S/C34H39NO4S/c1-33(2)28-20-21-34(33,25-40(37,38)30-16-10-5-11-17-30)31(22-28)39-32(36)23-29(19-18-26-12-6-3-7-13-26)35-24-27-14-8-4-9-15-27/h3-17,23,28,31,35H,18-22,24-25H2,1-2H3/b29-23-/t28-,31-,34-/m0/s1 |
| InChIKey | CUAQMZOPHZJNSL-DRIYXBQSSA-N |
| XLogP | 6.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|