C27H33NO4S — CID 102472939
[(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)but-2-enoate (PubChem CID 102472939) has the molecular formula C27H33NO4S and a molecular weight of 467.63 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)but-2-enoate.
| Compound Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)but-2-enoate |
|---|---|
| PubChem CID | 102472939 |
| Molecular Formula | C27H33NO4S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-3-(benzylamino)but-2-enoate |
| SMILES | C/C(=C/C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)C2(C)C)NCc1ccccc1 |
| InChI | InChI=1S/C27H33NO4S/c1-20(28-18-21-10-6-4-7-11-21)16-25(29)32-24-17-22-14-15-27(24,26(22,2)3)19-33(30,31)23-12-8-5-9-13-23/h4-13,16,22,24,28H,14-15,17-19H2,1-3H3/b20-16-/t22-,24-,27-/m1/s1 |
| InChIKey | NIOWLYKZRSDISI-LWNFRKQGSA-N |
| XLogP | 4.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|